CAS 381241-10-7 appears in our catalog under these names: N-[2-Nitro-4-(trifluoromethyl)phenyl]-1,3-propanediamine hydrochloride, 95%, N1-(2-Nitro-4-(trifluoromethyl)phenyl)propane-1,3-diamine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
N'-[2-nitro-4-(trifluoromethyl)phenyl]propane-1,3-diamine (CAS 381241-10-7) is a chemical compound with the molecular formula C10H12F3N3O2 and a molecular weight of 263.22 g/mol. IUPAC name: N'-[2-nitro-4-(trifluoromethyl)phenyl]propane-1,3-diamine. InChIKey: GPIAUHZGDZGEJK-UHFFFAOYSA-N.
| Molecular formula | C10H12F3N3O2 |
|---|---|
| Molecular weight | 263.22 g/mol |
| IUPAC name | N'-[2-nitro-4-(trifluoromethyl)phenyl]propane-1,3-diamine |
| InChIKey | GPIAUHZGDZGEJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])NCCCN |
Computed by PubChem (NCBI)