CAS 381241-12-9 is the registry number for N-[4-Nitro-2-(trifluoromethyl)phenyl]propane-1,3-diamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N'-[4-nitro-2-(trifluoromethyl)phenyl]propane-1,3-diamine (CAS 381241-12-9) is a chemical compound with the molecular formula C10H12F3N3O2 and a molecular weight of 263.22 g/mol. IUPAC name: N'-[4-nitro-2-(trifluoromethyl)phenyl]propane-1,3-diamine. InChIKey: XIUIJVYLNXWBFZ-UHFFFAOYSA-N.
| Molecular formula | C10H12F3N3O2 |
|---|---|
| Molecular weight | 263.22 g/mol |
| IUPAC name | N'-[4-nitro-2-(trifluoromethyl)phenyl]propane-1,3-diamine |
| InChIKey | XIUIJVYLNXWBFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)NCCCN |
Computed by PubChem (NCBI)