CAS 382173-94-6 is the registry number for 2-(((2,4,6-trioxo-3,5-diazaperhydroinylidene)methyl)amino)benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]benzoic acid (CAS 382173-94-6) is a chemical compound with the molecular formula C12H9N3O5 and a molecular weight of 275.22 g/mol. IUPAC name: 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]benzoic acid. InChIKey: BCMVLHLJUSGBEO-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O5 |
|---|---|
| Molecular weight | 275.22 g/mol |
| IUPAC name | 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]benzoic acid |
| InChIKey | BCMVLHLJUSGBEO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)N=CC2=C(NC(=O)NC2=O)O |
Computed by PubChem (NCBI)