Products 383131-81-5

CAS 383131-81-5 is the registry number for (5-tert-Butyl-2-methyl-1h-indol-3-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(5-tert-butyl-2-methyl-1H-indol-3-yl)acetic acid (CAS 383131-81-5) is a chemical compound with the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. IUPAC name: 2-(5-tert-butyl-2-methyl-1H-indol-3-yl)acetic acid. InChIKey: YVEVPVXDJZMHLX-UHFFFAOYSA-N.

Identity
Molecular formulaC15H19NO2
Molecular weight245.32 g/mol
IUPAC name2-(5-tert-butyl-2-methyl-1H-indol-3-yl)acetic acid
InChIKeyYVEVPVXDJZMHLX-UHFFFAOYSA-N
SMILESCC1=C(C2=C(N1)C=CC(=C2)C(C)(C)C)CC(=O)O

Computed by PubChem (NCBI)