Products 98598-94-8
CAS 98598-94-8 is the registry number for tert-Butyl 2,3-dimethyl-1h-indole-1-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
Tert-butyl 2,3-dimethylindole-1-carboxylate (CAS 98598-94-8) is a chemical compound with the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. IUPAC name: tert-butyl 2,3-dimethylindole-1-carboxylate. InChIKey: MWUGZZPQJQFYRE-UHFFFAOYSA-N.
| Molecular formula | C15H19NO2 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | tert-butyl 2,3-dimethylindole-1-carboxylate |
| InChIKey | MWUGZZPQJQFYRE-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C2=CC=CC=C12)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)