Products 383136-16-1
CAS 383136-16-1 is the registry number for 1-(3,4-Dimethylphenyl)-1H-pyrrole-2-carbaldehyde. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
1-(3,4-dimethylphenyl)pyrrole-2-carbaldehyde (CAS 383136-16-1) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: 1-(3,4-dimethylphenyl)pyrrole-2-carbaldehyde. InChIKey: RYKLHFRNQYWPQZ-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 1-(3,4-dimethylphenyl)pyrrole-2-carbaldehyde |
| InChIKey | RYKLHFRNQYWPQZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C=CC=C2C=O)C |
Computed by PubChem (NCBI)