CAS 383142-67-4 is the registry number for 4-(4-Bromo-phenyl)-thiazole-2-carbaldehyde. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(4-bromophenyl)-1,3-thiazole-2-carbaldehyde (CAS 383142-67-4) is a chemical compound with the molecular formula C10H6BrNOS and a molecular weight of 268.13 g/mol. IUPAC name: 4-(4-bromophenyl)-1,3-thiazole-2-carbaldehyde. InChIKey: KWYHBOLLADFDBQ-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNOS |
|---|---|
| Molecular weight | 268.13 g/mol |
| IUPAC name | 4-(4-bromophenyl)-1,3-thiazole-2-carbaldehyde |
| InChIKey | KWYHBOLLADFDBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=N2)C=O)Br |
Computed by PubChem (NCBI)