CAS 38329-34-9 is the registry number for (S)-phenylglycine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2S)-2-amino-2-phenylacetic acid;hydrochloride (CAS 38329-34-9) is a chemical compound with the molecular formula C8H10ClNO2 and a molecular weight of 187.62 g/mol. IUPAC name: (2S)-2-amino-2-phenylacetic acid;hydrochloride. InChIKey: IAZPUJDTYUZJMI-FJXQXJEOSA-N.
| Molecular formula | C8H10ClNO2 |
|---|---|
| Molecular weight | 187.62 g/mol |
| IUPAC name | (2S)-2-amino-2-phenylacetic acid;hydrochloride |
| InChIKey | IAZPUJDTYUZJMI-FJXQXJEOSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)