CAS 38345-66-3 is the registry number for (2S,3R)-4-(Dimethylamino)-1,2-diphenyl-3-methylbutan-2-ol (Oxyphene). Offered by: Mikromol. Available pack sizes: 25mg, 100mg.
(2S,3R)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-ol (CAS 38345-66-3) is a chemical compound with the molecular formula C19H25NO and a molecular weight of 283.4 g/mol. IUPAC name: (2S,3R)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-ol. InChIKey: INTCGJHAECYOBW-APWZRJJASA-N.
| Molecular formula | C19H25NO |
|---|---|
| Molecular weight | 283.4 g/mol |
| IUPAC name | (2S,3R)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-ol |
| InChIKey | INTCGJHAECYOBW-APWZRJJASA-N |
| SMILES | C[C@H](CN(C)C)[C@@](CC1=CC=CC=C1)(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)