CAS 38350-87-7 appears in our catalog under these names: 4-Heptylbenzoic acid, 98%, 4–Heptylbenzoicacid, 4-n-Heptylbenzoic acid, 99+% , 4-Heptylbenzoic Acid, >95.0%(GC)(T), 4-Heptylbenzoic acid, 98+%, 98+%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Chemat. Available pack sizes: 1g, 10g, 5g, 100g, 25g.
4-heptylbenzoic acid (CAS 38350-87-7) is a chemical compound with the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. IUPAC name: 4-heptylbenzoic acid. InChIKey: VSUKEWPHURLYTK-UHFFFAOYSA-N.
| Molecular formula | C14H20O2 |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | 4-heptylbenzoic acid |
| InChIKey | VSUKEWPHURLYTK-UHFFFAOYSA-N |
| SMILES | CCCCCCCC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)