CAS 38353-02-5 is the registry number for 2-Benzoyl-1H-imidazole, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
1H-imidazol-2-yl(phenyl)methanone (CAS 38353-02-5) is a chemical compound with the molecular formula C10H8N2O and a molecular weight of 172.18 g/mol. IUPAC name: 1H-imidazol-2-yl(phenyl)methanone. InChIKey: JUVDEAXMLQQRFP-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 1H-imidazol-2-yl(phenyl)methanone |
| InChIKey | JUVDEAXMLQQRFP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=NC=CN2 |
Computed by PubChem (NCBI)