Products 383670-74-4

CAS 383670-74-4 is the registry number for Ethyl 2,2-difluoro-2-(4-nitrophenoxy)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 2,2-difluoro-2-(4-nitrophenoxy)acetate (CAS 383670-74-4) is a chemical compound with the molecular formula C10H9F2NO5 and a molecular weight of 261.18 g/mol. IUPAC name: ethyl 2,2-difluoro-2-(4-nitrophenoxy)acetate. InChIKey: PZDDODIICBJHOQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9F2NO5
Molecular weight261.18 g/mol
IUPAC nameethyl 2,2-difluoro-2-(4-nitrophenoxy)acetate
InChIKeyPZDDODIICBJHOQ-UHFFFAOYSA-N
SMILESCCOC(=O)C(OC1=CC=C(C=C1)[N+](=O)[O-])(F)F

Computed by PubChem (NCBI)