CAS 383670-91-5 is the registry number for Ethyl 2,2-difluoro-2-(3-nitrophenoxy)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 2,2-difluoro-2-(3-nitrophenoxy)acetate (CAS 383670-91-5) is a chemical compound with the molecular formula C10H9F2NO5 and a molecular weight of 261.18 g/mol. IUPAC name: ethyl 2,2-difluoro-2-(3-nitrophenoxy)acetate. InChIKey: JRIGUJXGRHFDTK-UHFFFAOYSA-N.
| Molecular formula | C10H9F2NO5 |
|---|---|
| Molecular weight | 261.18 g/mol |
| IUPAC name | ethyl 2,2-difluoro-2-(3-nitrophenoxy)acetate |
| InChIKey | JRIGUJXGRHFDTK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(OC1=CC=CC(=C1)[N+](=O)[O-])(F)F |
Computed by PubChem (NCBI)