Products 38376-29-3
CAS 38376-29-3 appears in our catalog under these names: VU0420373, VU0420373, 99.99%, VU0420373, 98%, 2-(5-(2-Fluorophenyl)-1H-pyrazol-3-yl)phenol, 98%, VU0420373, 99.62%. Offered by: GLPBio, MedChemExpress, Ambeed, BLDpharm, Chemat. Available pack sizes: 5mg, 25 mg, 10mM/1mL, 5 mg, 50 mg, 10 mg, 100 mg, 100mg.
2-[5-(2-fluorophenyl)-1H-pyrazol-3-yl]phenol (CAS 38376-29-3) is a chemical compound with the molecular formula C15H11FN2O and a molecular weight of 254.26 g/mol. IUPAC name: 2-[5-(2-fluorophenyl)-1H-pyrazol-3-yl]phenol. InChIKey: SJPGLKXXUIEFLO-UHFFFAOYSA-N.
| Molecular formula | C15H11FN2O |
|---|---|
| Molecular weight | 254.26 g/mol |
| IUPAC name | 2-[5-(2-fluorophenyl)-1H-pyrazol-3-yl]phenol |
| InChIKey | SJPGLKXXUIEFLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNC(=C2)C3=CC=CC=C3F)O |
Computed by PubChem (NCBI)