CAS 38395-78-7 appears in our catalog under these names: 1-(4-Nitrophenyl)hexane, 95%, 1-Hexyl-4-nitrobenzene 97%, 1-(4-Nitrophenyl)hexane, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-hexyl-4-nitrobenzene (CAS 38395-78-7) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: 1-hexyl-4-nitrobenzene. InChIKey: YLWXUZXLBPAZJZ-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 1-hexyl-4-nitrobenzene |
| InChIKey | YLWXUZXLBPAZJZ-UHFFFAOYSA-N |
| SMILES | CCCCCCC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)