Products 38412-82-7
CAS 38412-82-7 is the registry number for 3,4,4',7-Tetrahydroxyflavan. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
(2R,3S,4R)-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,7-triol (CAS 38412-82-7) is a chemical compound with the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. IUPAC name: (2R,3S,4R)-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,7-triol. InChIKey: NTLUSUFJOUMRLA-QLFBSQMISA-N.
| Molecular formula | C15H14O5 |
|---|---|
| Molecular weight | 274.27 g/mol |
| IUPAC name | (2R,3S,4R)-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,7-triol |
| InChIKey | NTLUSUFJOUMRLA-QLFBSQMISA-N |
| SMILES | C1=CC(=CC=C1[C@@H]2[C@H]([C@@H](C3=C(O2)C=C(C=C3)O)O)O)O |
Computed by PubChem (NCBI)