Products 38470-71-2
CAS 38470-71-2 is the registry number for MAO-B-IN-26. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(4-bromophenyl)-1-(1H-indol-3-yl)prop-2-en-1-one (CAS 38470-71-2) is a chemical compound with the molecular formula C17H12BrNO and a molecular weight of 326.2 g/mol. IUPAC name: (E)-3-(4-bromophenyl)-1-(1H-indol-3-yl)prop-2-en-1-one. InChIKey: RVUJDYIDVJKIFK-JXMROGBWSA-N.
| Molecular formula | C17H12BrNO |
|---|---|
| Molecular weight | 326.2 g/mol |
| IUPAC name | (E)-3-(4-bromophenyl)-1-(1H-indol-3-yl)prop-2-en-1-one |
| InChIKey | RVUJDYIDVJKIFK-JXMROGBWSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)/C=C/C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)