CAS 430460-55-2 is the registry number for 2-[(E)-2-(2-Bromophenyl)vinyl]quinolin-8-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2-[(E)-2-(2-bromophenyl)ethenyl]quinolin-8-ol (CAS 430460-55-2) is a chemical compound with the molecular formula C17H12BrNO and a molecular weight of 326.2 g/mol. IUPAC name: 2-[(E)-2-(2-bromophenyl)ethenyl]quinolin-8-ol. InChIKey: XFDOYOJBVKGWCY-CSKARUKUSA-N.
| Molecular formula | C17H12BrNO |
|---|---|
| Molecular weight | 326.2 g/mol |
| IUPAC name | 2-[(E)-2-(2-bromophenyl)ethenyl]quinolin-8-ol |
| InChIKey | XFDOYOJBVKGWCY-CSKARUKUSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C2=NC3=C(C=CC=C3O)C=C2)Br |
Computed by PubChem (NCBI)