CAS 3852-84-4 is the registry number for Triflupromazine Sulfone. Offered by: Mikromol. Available pack sizes: 25mg.
3-[5,5-dioxo-2-(trifluoromethyl)phenothiazin-10-yl]-N,N-dimethylpropan-1-amine (CAS 3852-84-4) is a chemical compound with the molecular formula C18H19F3N2O2S and a molecular weight of 384.4 g/mol. IUPAC name: 3-[5,5-dioxo-2-(trifluoromethyl)phenothiazin-10-yl]-N,N-dimethylpropan-1-amine. InChIKey: IQPWLKFDSUDGJK-UHFFFAOYSA-N.
| Molecular formula | C18H19F3N2O2S |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | 3-[5,5-dioxo-2-(trifluoromethyl)phenothiazin-10-yl]-N,N-dimethylpropan-1-amine |
| InChIKey | IQPWLKFDSUDGJK-UHFFFAOYSA-N |
| SMILES | CN(C)CCCN1C2=CC=CC=C2S(=O)(=O)C3=C1C=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)