CAS 94163-91-4 is the registry number for Triflupromazine Sulfoxide N-Oxide (Triflupromazine N,S-Dioxide). Offered by: Mikromol. Available pack sizes: 25mg.
N,N-dimethyl-3-[5-oxo-2-(trifluoromethyl)phenothiazin-10-yl]propan-1-amine oxide (CAS 94163-91-4) is a chemical compound with the molecular formula C18H19F3N2O2S and a molecular weight of 384.4 g/mol. IUPAC name: N,N-dimethyl-3-[5-oxo-2-(trifluoromethyl)phenothiazin-10-yl]propan-1-amine oxide. InChIKey: OTLRYPZOEZYXJK-UHFFFAOYSA-N.
| Molecular formula | C18H19F3N2O2S |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | N,N-dimethyl-3-[5-oxo-2-(trifluoromethyl)phenothiazin-10-yl]propan-1-amine oxide |
| InChIKey | OTLRYPZOEZYXJK-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCCN1C2=CC=CC=C2S(=O)C3=C1C=C(C=C3)C(F)(F)F)[O-] |
Computed by PubChem (NCBI)