CAS 385376-38-5 is the registry number for 5-{((4-Fluorophenyl)methyl)amino}-2,3-dihydro-1H-1,3-benzodiazol-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-[(4-fluorophenyl)methylamino]-1,3-dihydrobenzimidazol-2-one (CAS 385376-38-5) is a chemical compound with the molecular formula C14H12FN3O and a molecular weight of 257.26 g/mol. IUPAC name: 5-[(4-fluorophenyl)methylamino]-1,3-dihydrobenzimidazol-2-one. InChIKey: QVFKZLKQPMWAAA-UHFFFAOYSA-N.
| Molecular formula | C14H12FN3O |
|---|---|
| Molecular weight | 257.26 g/mol |
| IUPAC name | 5-[(4-fluorophenyl)methylamino]-1,3-dihydrobenzimidazol-2-one |
| InChIKey | QVFKZLKQPMWAAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC2=CC3=C(C=C2)NC(=O)N3)F |
Computed by PubChem (NCBI)