CAS 895831-76-2 is the registry number for 3-(4-Fluorophenyl)-2,5-dimethylpyrazolo(1,5-a)pyrimidin-7-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(4-fluorophenyl)-2,5-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (CAS 895831-76-2) is a chemical compound with the molecular formula C14H12FN3O and a molecular weight of 257.26 g/mol. IUPAC name: 3-(4-fluorophenyl)-2,5-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one. InChIKey: DQVSESQDBDDVGC-UHFFFAOYSA-N.
| Molecular formula | C14H12FN3O |
|---|---|
| Molecular weight | 257.26 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-2,5-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| InChIKey | DQVSESQDBDDVGC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=N1)C(=C(N2)C)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)