Products 385808-55-9
CAS 385808-55-9 is the registry number for O2-tert-butyl O6-methyl (1R,4R,6S)-5-benzyl-2,5-diazabicyclo[2.2.1]heptane-2,6-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-O-tert-butyl 6-O-methyl (1R,4R,6S)-5-benzyl-2,5-diazabicyclo[2.2.1]heptane-2,6-dicarboxylate (CAS 385808-55-9) is a chemical compound with the molecular formula C19H26N2O4 and a molecular weight of 346.4 g/mol. IUPAC name: 2-O-tert-butyl 6-O-methyl (1R,4R,6S)-5-benzyl-2,5-diazabicyclo[2.2.1]heptane-2,6-dicarboxylate. InChIKey: FRIPQHBNHWTFNA-OAGGEKHMSA-N.
| Molecular formula | C19H26N2O4 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 2-O-tert-butyl 6-O-methyl (1R,4R,6S)-5-benzyl-2,5-diazabicyclo[2.2.1]heptane-2,6-dicarboxylate |
| InChIKey | FRIPQHBNHWTFNA-OAGGEKHMSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@H]1[C@H](N2CC3=CC=CC=C3)C(=O)OC |
Computed by PubChem (NCBI)