CAS 3861-76-5 appears in our catalog under these names: Clonitazene (1.0mg/ml in Acetonitrile), Clonitazene, >95% (HPLC). Offered by: TRC. Available pack sizes: 1x1ml, 10mg, 2,5mg, 20mg.
2-[2-[(4-chlorophenyl)methyl]-5-nitrobenzimidazol-1-yl]-N,N-diethylethanamine (CAS 3861-76-5) is a chemical compound with the molecular formula C20H23ClN4O2 and a molecular weight of 386.9 g/mol. IUPAC name: 2-[2-[(4-chlorophenyl)methyl]-5-nitrobenzimidazol-1-yl]-N,N-diethylethanamine. InChIKey: GPZLDQAEBHTMPG-UHFFFAOYSA-N.
| Molecular formula | C20H23ClN4O2 |
|---|---|
| Molecular weight | 386.9 g/mol |
| IUPAC name | 2-[2-[(4-chlorophenyl)methyl]-5-nitrobenzimidazol-1-yl]-N,N-diethylethanamine |
| InChIKey | GPZLDQAEBHTMPG-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCN1C2=C(C=C(C=C2)[N+](=O)[O-])N=C1CC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)