Products 38678-69-2
CAS 38678-69-2 appears in our catalog under these names: H–Phe–Trp–NH₂ · HCl, H-Phe-Trp-NH2·HCl. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 25mg, 50mg, 100mg.
(2S)-2-amino-N-[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-3-phenylpropanamide;hydrochloride (CAS 38678-69-2) is a chemical compound with the molecular formula C20H23ClN4O2 and a molecular weight of 386.9 g/mol. IUPAC name: (2S)-2-amino-N-[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-3-phenylpropanamide;hydrochloride. InChIKey: JKTLXWKTORYRNG-AKXYIILFSA-N.
| Molecular formula | C20H23ClN4O2 |
|---|---|
| Molecular weight | 386.9 g/mol |
| IUPAC name | (2S)-2-amino-N-[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-3-phenylpropanamide;hydrochloride |
| InChIKey | JKTLXWKTORYRNG-AKXYIILFSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N[C@@H](CC2=CNC3=CC=CC=C32)C(=O)N)N.Cl |
Computed by PubChem (NCBI)