CAS 38675-31-9 appears in our catalog under these names: 4-Phenylpyrimidin-2-ol, 95%, 4–Phenylpyrimidin–2–ol, 4-phenylpyrimidin-2-ol. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g.
6-phenyl-1H-pyrimidin-2-one (CAS 38675-31-9) is a chemical compound with the molecular formula C10H8N2O and a molecular weight of 172.18 g/mol. IUPAC name: 6-phenyl-1H-pyrimidin-2-one. InChIKey: LDORHCBMWSQLIU-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 6-phenyl-1H-pyrimidin-2-one |
| InChIKey | LDORHCBMWSQLIU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=NC(=O)N2 |
Computed by PubChem (NCBI)