CAS 38695-10-2 is the registry number for (4-(4-Fluorophenoxy)phenyl)-N,N-dimethylamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
4-(4-fluorophenoxy)-N,N-dimethylaniline (CAS 38695-10-2) is a chemical compound with the molecular formula C14H14FNO and a molecular weight of 231.26 g/mol. IUPAC name: 4-(4-fluorophenoxy)-N,N-dimethylaniline. InChIKey: LRGLMTXKOVGZMF-UHFFFAOYSA-N.
| Molecular formula | C14H14FNO |
|---|---|
| Molecular weight | 231.26 g/mol |
| IUPAC name | 4-(4-fluorophenoxy)-N,N-dimethylaniline |
| InChIKey | LRGLMTXKOVGZMF-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)OC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)