Products 387356-03-8

CAS 387356-03-8 is the registry number for N-Nitroso Tapentadol Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

N-[2-methoxy-2-(3-methoxyphenyl)ethyl]-N-methylnitrous amide (CAS 387356-03-8) is a chemical compound with the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. IUPAC name: N-[2-methoxy-2-(3-methoxyphenyl)ethyl]-N-methylnitrous amide. InChIKey: JKPPYZZZPHSMOQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16N2O3
Molecular weight224.26 g/mol
IUPAC nameN-[2-methoxy-2-(3-methoxyphenyl)ethyl]-N-methylnitrous amide
InChIKeyJKPPYZZZPHSMOQ-UHFFFAOYSA-N
SMILESCN(CC(C1=CC(=CC=C1)OC)OC)N=O

Computed by PubChem (NCBI)