Products 893750-05-5

CAS 893750-05-5 is the registry number for 5-Methyl-4-(piperidin-1-ylmethyl)isoxazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.

Structural formula: {0} (CAS {1})

5-methyl-4-(piperidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid (CAS 893750-05-5) is a chemical compound with the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. IUPAC name: 5-methyl-4-(piperidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid. InChIKey: OCTCTEVMLMPUQO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16N2O3
Molecular weight224.26 g/mol
IUPAC name5-methyl-4-(piperidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid
InChIKeyOCTCTEVMLMPUQO-UHFFFAOYSA-N
SMILESCC1=C(C(=NO1)C(=O)O)CN2CCCCC2

Computed by PubChem (NCBI)