Products 887594-13-0
CAS 887594-13-0 is the registry number for 3-(2-Cyano-acetyl)-azetidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg, 100mg.
Tert-butyl 3-(2-cyanoacetyl)azetidine-1-carboxylate (CAS 887594-13-0) is a chemical compound with the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. IUPAC name: tert-butyl 3-(2-cyanoacetyl)azetidine-1-carboxylate. InChIKey: MWQMPWWBTIXHQH-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O3 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | tert-butyl 3-(2-cyanoacetyl)azetidine-1-carboxylate |
| InChIKey | MWQMPWWBTIXHQH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C(=O)CC#N |
Computed by PubChem (NCBI)