CAS 387358-53-4 appears in our catalog under these names: 2,3-Difluorobenzoic acid hydrazide, 95%, 2,3-Difluorobenzohydrazide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2,3-difluorobenzohydrazide (CAS 387358-53-4) is a chemical compound with the molecular formula C7H6F2N2O and a molecular weight of 172.13 g/mol. IUPAC name: 2,3-difluorobenzohydrazide. InChIKey: OTAQPODTRVCAKB-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 2,3-difluorobenzohydrazide |
| InChIKey | OTAQPODTRVCAKB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C(=O)NN |
Computed by PubChem (NCBI)