CAS 874880-59-8 is the registry number for 3,5-Difluorobenzamidoxime, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
3,5-difluoro-N'-hydroxybenzenecarboximidamide (CAS 874880-59-8) is a chemical compound with the molecular formula C7H6F2N2O and a molecular weight of 172.13 g/mol. IUPAC name: 3,5-difluoro-N'-hydroxybenzenecarboximidamide. InChIKey: GYTSCORJTXOMMI-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 3,5-difluoro-N'-hydroxybenzenecarboximidamide |
| InChIKey | GYTSCORJTXOMMI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)/C(=N/O)/N |
Computed by PubChem (NCBI)