CAS 3880-78-2 appears in our catalog under these names: 7-Methoxy-1,2,3,4-tetrahydronaphthalen-2-ylamine hydrochloride, 7-Methoxy-1,2,3,4-tetrahydro-naphthalen-2-ylamine hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1g, 250mg, 5g.
7-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride (CAS 3880-78-2) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 7-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride. InChIKey: PMBXUCCIODNPGO-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 7-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride |
| InChIKey | PMBXUCCIODNPGO-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CCC(C2)N)C=C1.Cl |
Computed by PubChem (NCBI)