CAS 38805-89-9 is the registry number for (1S,2R)-2-Phenylcyclopentan-1-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Trans-(1S,2R)-2-phenylcyclopentan-1-ol (CAS 38805-89-9) is a chemical compound with the molecular formula C11H14O and a molecular weight of 162.23 g/mol. IUPAC name: trans-(1S,2R)-2-phenylcyclopentan-1-ol. InChIKey: GKYMKMKCZAPNTK-MNOVXSKESA-N.
| Molecular formula | C11H14O |
|---|---|
| Molecular weight | 162.23 g/mol |
| IUPAC name | trans-(1S,2R)-2-phenylcyclopentan-1-ol |
| InChIKey | GKYMKMKCZAPNTK-MNOVXSKESA-N |
| SMILES | C1C[C@@H]([C@H](C1)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)