Products 3889-59-6

CAS 3889-59-6 is the registry number for Dichloro-1,2-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3,5-dichloro-1,2-thiazole-4-carboxylic acid (CAS 3889-59-6) is a chemical compound with the molecular formula C4HCl2NO2S and a molecular weight of 198.03 g/mol. IUPAC name: 3,5-dichloro-1,2-thiazole-4-carboxylic acid. InChIKey: WKAITTMZJQQYEI-UHFFFAOYSA-N.

Identity
Molecular formulaC4HCl2NO2S
Molecular weight198.03 g/mol
IUPAC name3,5-dichloro-1,2-thiazole-4-carboxylic acid
InChIKeyWKAITTMZJQQYEI-UHFFFAOYSA-N
SMILESC1(=C(SN=C1Cl)Cl)C(=O)O

Computed by PubChem (NCBI)