CAS 62019-55-0 appears in our catalog under these names: 4,5-Dichlorothiazole-2-carboxylic acid, 95+%, Dichloro-1,3-thiazole-2-carboxylic acid, dichloro-1,3-thiazole-2-carboxylic acid, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 10g, 5g, 100mg, 50mg, 250mg, 1000mg, 500mg.
4,5-dichloro-1,3-thiazole-2-carboxylic acid (CAS 62019-55-0) is a chemical compound with the molecular formula C4HCl2NO2S and a molecular weight of 198.03 g/mol. IUPAC name: 4,5-dichloro-1,3-thiazole-2-carboxylic acid. InChIKey: GEMRCIPPTRQSQV-UHFFFAOYSA-N.
| Molecular formula | C4HCl2NO2S |
|---|---|
| Molecular weight | 198.03 g/mol |
| IUPAC name | 4,5-dichloro-1,3-thiazole-2-carboxylic acid |
| InChIKey | GEMRCIPPTRQSQV-UHFFFAOYSA-N |
| SMILES | C1(=C(SC(=N1)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)