CAS 3893-10-5 is the registry number for 1-(4-Methoxyphenyl)-6-phenylhexatriene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-methoxy-4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene (CAS 3893-10-5) is a chemical compound with the molecular formula C19H18O and a molecular weight of 262.3 g/mol. IUPAC name: 1-methoxy-4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene. InChIKey: WSZUPMMXEJRMRA-SVRHENQESA-N.
| Molecular formula | C19H18O |
|---|---|
| Molecular weight | 262.3 g/mol |
| IUPAC name | 1-methoxy-4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene |
| InChIKey | WSZUPMMXEJRMRA-SVRHENQESA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C=C/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)