CAS 39777-55-4 appears in our catalog under these names: (1E,4E)-1,5-Di-p-tolylpenta-1,4-dien-3-one, 95-<97%, (1e,4e)-1,5-Di-p-tolylpenta-1,4-dien-3-one. Offered by: Hoffman Fine Chemicals, TRC. Available pack sizes: 25g, 50g, 100g, 100mg.
(1E,4E)-1,5-bis(4-methylphenyl)penta-1,4-dien-3-one (CAS 39777-55-4) is a chemical compound with the molecular formula C19H18O and a molecular weight of 262.3 g/mol. IUPAC name: (1E,4E)-1,5-bis(4-methylphenyl)penta-1,4-dien-3-one. InChIKey: GPAAWNJDOIZWQD-PHEQNACWSA-N.
| Molecular formula | C19H18O |
|---|---|
| Molecular weight | 262.3 g/mol |
| IUPAC name | (1E,4E)-1,5-bis(4-methylphenyl)penta-1,4-dien-3-one |
| InChIKey | GPAAWNJDOIZWQD-PHEQNACWSA-N |
| SMILES | CC1=CC=C(C=C1)/C=C/C(=O)/C=C/C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)