Products 38980-91-5
CAS 38980-91-5 appears in our catalog under these names: 4-(4-Chlorophenyl)-1-methyl-1H-imidazole, 95%, 4-(4-Chlorophenyl)-1-methyl-1H-imidazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(4-chlorophenyl)-1-methylimidazole (CAS 38980-91-5) is a chemical compound with the molecular formula C10H9ClN2 and a molecular weight of 192.64 g/mol. IUPAC name: 4-(4-chlorophenyl)-1-methylimidazole. InChIKey: HNSHEMLQWGMAOO-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2 |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-1-methylimidazole |
| InChIKey | HNSHEMLQWGMAOO-UHFFFAOYSA-N |
| SMILES | CN1C=C(N=C1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)