CAS 39031-76-0 is the registry number for 4-Nitrophenyl b-D-galactopyranosiduronic acid. Offered by: Biosynth. Available pack sizes: 100mg.
3,4,5-trihydroxy-6-(4-nitrophenoxy)oxane-2-carboxylic acid (CAS 39031-76-0) is a chemical compound with the molecular formula C12H13NO9 and a molecular weight of 315.23 g/mol. IUPAC name: 3,4,5-trihydroxy-6-(4-nitrophenoxy)oxane-2-carboxylic acid. InChIKey: QSUILVWOWLUOEU-UHFFFAOYSA-N.
| Molecular formula | C12H13NO9 |
|---|---|
| Molecular weight | 315.23 g/mol |
| IUPAC name | 3,4,5-trihydroxy-6-(4-nitrophenoxy)oxane-2-carboxylic acid |
| InChIKey | QSUILVWOWLUOEU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2C(C(C(C(O2)C(=O)O)O)O)O |
Computed by PubChem (NCBI)