Products 39031-76-0

CAS 39031-76-0 is the registry number for 4-Nitrophenyl b-D-galactopyranosiduronic acid. Offered by: Biosynth. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

3,4,5-trihydroxy-6-(4-nitrophenoxy)oxane-2-carboxylic acid (CAS 39031-76-0) is a chemical compound with the molecular formula C12H13NO9 and a molecular weight of 315.23 g/mol. IUPAC name: 3,4,5-trihydroxy-6-(4-nitrophenoxy)oxane-2-carboxylic acid. InChIKey: QSUILVWOWLUOEU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NO9
Molecular weight315.23 g/mol
IUPAC name3,4,5-trihydroxy-6-(4-nitrophenoxy)oxane-2-carboxylic acid
InChIKeyQSUILVWOWLUOEU-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1[N+](=O)[O-])OC2C(C(C(C(O2)C(=O)O)O)O)O

Computed by PubChem (NCBI)