CAS 39038-19-2 appears in our catalog under these names: Methimazole Thio-beta-D-glucuronide, Methimazole thio-b-D-glucuronide. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 2mg, 1mg, 5mg, 10mg.
(3R,6R)-3,4,5-trihydroxy-6-(1-methylimidazol-2-yl)sulfanyloxane-2-carboxylic acid (CAS 39038-19-2) is a chemical compound with the molecular formula C10H14N2O6S and a molecular weight of 290.30 g/mol. IUPAC name: (3R,6R)-3,4,5-trihydroxy-6-(1-methylimidazol-2-yl)sulfanyloxane-2-carboxylic acid. InChIKey: KENJCTIXBHPRDX-ARXGFGQCSA-N.
| Molecular formula | C10H14N2O6S |
|---|---|
| Molecular weight | 290.30 g/mol |
| IUPAC name | (3R,6R)-3,4,5-trihydroxy-6-(1-methylimidazol-2-yl)sulfanyloxane-2-carboxylic acid |
| InChIKey | KENJCTIXBHPRDX-ARXGFGQCSA-N |
| SMILES | CN1C=CN=C1S[C@@H]2C(C([C@H](C(O2)C(=O)O)O)O)O |
Computed by PubChem (NCBI)