CAS 57457-59-7 is the registry number for Cefazedone Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-5-(acetyloxymethyl)-2-[(R)-amino(carboxy)methyl]-3,6-dihydro-2H-1,3-thiazine-4-carboxylic acid (CAS 57457-59-7) is a chemical compound with the molecular formula C10H14N2O6S and a molecular weight of 290.30 g/mol. IUPAC name: (2R)-5-(acetyloxymethyl)-2-[(R)-amino(carboxy)methyl]-3,6-dihydro-2H-1,3-thiazine-4-carboxylic acid. InChIKey: IITQFJHMKHZPRB-POYBYMJQSA-N.
| Molecular formula | C10H14N2O6S |
|---|---|
| Molecular weight | 290.30 g/mol |
| IUPAC name | (2R)-5-(acetyloxymethyl)-2-[(R)-amino(carboxy)methyl]-3,6-dihydro-2H-1,3-thiazine-4-carboxylic acid |
| InChIKey | IITQFJHMKHZPRB-POYBYMJQSA-N |
| SMILES | CC(=O)OCC1=C(N[C@H](SC1)[C@@H](C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)