CAS 390388-88-2 is the registry number for (2,2-Bis(trifluoromethyl)cyclopropyl)methanol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
[2,2-bis(trifluoromethyl)cyclopropyl]methanol (CAS 390388-88-2) is a chemical compound with the molecular formula C6H6F6O and a molecular weight of 208.10 g/mol. IUPAC name: [2,2-bis(trifluoromethyl)cyclopropyl]methanol. InChIKey: YKHKDTDAAOZNFV-UHFFFAOYSA-N.
| Molecular formula | C6H6F6O |
|---|---|
| Molecular weight | 208.10 g/mol |
| IUPAC name | [2,2-bis(trifluoromethyl)cyclopropyl]methanol |
| InChIKey | YKHKDTDAAOZNFV-UHFFFAOYSA-N |
| SMILES | C1C(C1(C(F)(F)F)C(F)(F)F)CO |
Computed by PubChem (NCBI)