CAS 39088-05-6 appears in our catalog under these names: 2-Hydroxy-4,6-dimethylnicotinamide, 97%, 2-Hydroxy-4,6-dimethylnicotinamide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g.
4,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide (CAS 39088-05-6) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 4,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide. InChIKey: FVNMEZMALQNFNF-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 4,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide |
| InChIKey | FVNMEZMALQNFNF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=O)N1)C(=O)N)C |
Computed by PubChem (NCBI)