CAS 391-78-6 appears in our catalog under these names: 6–Fluoro–4–hydroxyquinoline, 6-Fluoroquinolin-4-ol, 6-Fluoro-4-hydroxyquinoline 98%, 6-Fluoro-4-hydroxyquinoline, 95%, 6-Fluoroquinolin-4-ol, 97%, 97%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 100g, 10g, 250mg, 25g, 2.5g, 50g.
6-fluoro-1H-quinolin-4-one (CAS 391-78-6) is a chemical compound with the molecular formula C9H6FNO and a molecular weight of 163.15 g/mol. IUPAC name: 6-fluoro-1H-quinolin-4-one. InChIKey: BYZXOYSEYWCLOK-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 6-fluoro-1H-quinolin-4-one |
| InChIKey | BYZXOYSEYWCLOK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=O)C=CN2 |
Computed by PubChem (NCBI)