CAS 3910-51-8 appears in our catalog under these names: 2-Chloro-n-(2,4,6-trimethyl-phenyl)-acetamide, 95%, Chloracetmesidide, >95% (HPLC), 2-Chloro-N-mesitylacetamide 95%, 2-Chloro-N-mesitylacetamide, 95%, 95%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 500mg.
2-chloro-N-(2,4,6-trimethylphenyl)acetamide (CAS 3910-51-8) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. IUPAC name: 2-chloro-N-(2,4,6-trimethylphenyl)acetamide. InChIKey: YQYQXBOOGVRRKI-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | 2-chloro-N-(2,4,6-trimethylphenyl)acetamide |
| InChIKey | YQYQXBOOGVRRKI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC(=O)CCl)C |
Computed by PubChem (NCBI)