CAS 39102-26-6 appears in our catalog under these names: 2-Phenyl-2h-1,2,3-triazol-4-amine, 95%, 2-Phenyl-2H-1,2,3-triazol-4-amine, 2-Phenyl-2H-1,2,3-triazol-4-amine, 97%. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 2,5g, 0,5g, 50mg.
2-phenyltriazol-4-amine (CAS 39102-26-6) is a chemical compound with the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. IUPAC name: 2-phenyltriazol-4-amine. InChIKey: VJOJLJGJYMRISA-UHFFFAOYSA-N.
| Molecular formula | C8H8N4 |
|---|---|
| Molecular weight | 160.18 g/mol |
| IUPAC name | 2-phenyltriazol-4-amine |
| InChIKey | VJOJLJGJYMRISA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2N=CC(=N2)N |
Computed by PubChem (NCBI)