CAS 61645-34-9 appears in our catalog under these names: 2-Hydrazinoquinoxaline, 95%, 2–Hydrazinylquinoxaline, 2-Hydrazinoquinoxaline, 2-Hydrazinylquinoxaline 95%, 2-Hydrazinylquinoxaline, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
Quinoxalin-2-ylhydrazine (CAS 61645-34-9) is a chemical compound with the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. IUPAC name: quinoxalin-2-ylhydrazine. InChIKey: GULVDPYLWVXKGC-UHFFFAOYSA-N.
| Molecular formula | C8H8N4 |
|---|---|
| Molecular weight | 160.18 g/mol |
| IUPAC name | quinoxalin-2-ylhydrazine |
| InChIKey | GULVDPYLWVXKGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC(=N2)NN |
Computed by PubChem (NCBI)