Products 39161-17-6

CAS 39161-17-6 appears in our catalog under these names: 2,2-Dimethyltetrahydrofuran-3-carboxylic acid, 95%, 2,2-Dimethyltetrahydrofuran-3-carboxylic Acid, >95%, >95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2,2-dimethyloxolane-3-carboxylic acid (CAS 39161-17-6) is a chemical compound with the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. IUPAC name: 2,2-dimethyloxolane-3-carboxylic acid. InChIKey: UMNSNBRDICMZHL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12O3
Molecular weight144.17 g/mol
IUPAC name2,2-dimethyloxolane-3-carboxylic acid
InChIKeyUMNSNBRDICMZHL-UHFFFAOYSA-N
SMILESCC1(C(CCO1)C(=O)O)C

Computed by PubChem (NCBI)