Products 391649-80-2
CAS 391649-80-2 is the registry number for N-(4-(2-nitrilo-4,4-dimethyl-3-oxopent-1-enyl)phenyl)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[4-[(Z)-2-cyano-4,4-dimethyl-3-oxopent-1-enyl]phenyl]acetamide (CAS 391649-80-2) is a chemical compound with the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. IUPAC name: N-[4-[(Z)-2-cyano-4,4-dimethyl-3-oxopent-1-enyl]phenyl]acetamide. InChIKey: JLSPSQACWWQLSH-LCYFTJDESA-N.
| Molecular formula | C16H18N2O2 |
|---|---|
| Molecular weight | 270.33 g/mol |
| IUPAC name | N-[4-[(Z)-2-cyano-4,4-dimethyl-3-oxopent-1-enyl]phenyl]acetamide |
| InChIKey | JLSPSQACWWQLSH-LCYFTJDESA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)/C=C(/C#N)\C(=O)C(C)(C)C |
Computed by PubChem (NCBI)